Spaces:
Running
Running
| { | |
| "edges": [ | |
| { | |
| "id": "Import CSV 1 Parse SMILES 1", | |
| "source": "Import CSV 1", | |
| "sourceHandle": "output", | |
| "target": "Parse SMILES 1", | |
| "targetHandle": "bundle" | |
| }, | |
| { | |
| "id": "Parse SMILES 1 Graph from molecule similarity 1", | |
| "source": "Parse SMILES 1", | |
| "sourceHandle": "output", | |
| "target": "Graph from molecule similarity 1", | |
| "targetHandle": "bundle" | |
| }, | |
| { | |
| "id": "Graph from molecule similarity 1 Visualize graph 1", | |
| "source": "Graph from molecule similarity 1", | |
| "sourceHandle": "output", | |
| "target": "Visualize graph 1", | |
| "targetHandle": "graph" | |
| }, | |
| { | |
| "id": "Graph from molecule similarity 1 Cypher 1", | |
| "source": "Graph from molecule similarity 1", | |
| "sourceHandle": "output", | |
| "target": "Cypher 1", | |
| "targetHandle": "bundle" | |
| }, | |
| { | |
| "id": "Cypher 1 View tables 1", | |
| "source": "Cypher 1", | |
| "sourceHandle": "output", | |
| "target": "View tables 1", | |
| "targetHandle": "bundle" | |
| } | |
| ], | |
| "env": "LynxKite Graph Analytics", | |
| "nodes": [ | |
| { | |
| "data": { | |
| "__execution_delay": 0.0, | |
| "collapsed": null, | |
| "display": null, | |
| "error": null, | |
| "input_metadata": [], | |
| "meta": { | |
| "color": "orange", | |
| "inputs": [], | |
| "name": "Import CSV", | |
| "outputs": [ | |
| { | |
| "name": "output", | |
| "position": "right", | |
| "type": { | |
| "type": "None" | |
| } | |
| } | |
| ], | |
| "params": [ | |
| { | |
| "default": null, | |
| "name": "filename", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| }, | |
| { | |
| "default": "<from file>", | |
| "name": "columns", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| }, | |
| { | |
| "default": "<auto>", | |
| "name": "separator", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| } | |
| ], | |
| "type": "basic" | |
| }, | |
| "params": { | |
| "columns": "<from file>", | |
| "filename": "uploads/drug_target_data_sample.csv", | |
| "separator": "<auto>" | |
| }, | |
| "status": "done", | |
| "title": "Import CSV" | |
| }, | |
| "dragHandle": ".bg-primary", | |
| "height": 200.0, | |
| "id": "Import CSV 1", | |
| "position": { | |
| "x": 300.92214591096035, | |
| "y": 1018.8292637889027 | |
| }, | |
| "type": "basic", | |
| "width": 200.0 | |
| }, | |
| { | |
| "data": { | |
| "display": null, | |
| "error": null, | |
| "input_metadata": [ | |
| { | |
| "dataframes": { | |
| "df": { | |
| "columns": [ | |
| "ACCESSION", | |
| "ACTION_TYPE", | |
| "ACT_COMMENT", | |
| "ACT_SOURCE", | |
| "ACT_SOURCE_URL", | |
| "ACT_TYPE", | |
| "ACT_UNIT", | |
| "ACT_VALUE", | |
| "DRUG_NAME", | |
| "GENE", | |
| "INN", | |
| "InChI", | |
| "InChIKey", | |
| "MOA", | |
| "MOA_SOURCE", | |
| "MOA_SOURCE_URL", | |
| "ORGANISM", | |
| "RELATION", | |
| "SMILES", | |
| "STRUCT_ID", | |
| "SWISSPROT", | |
| "TARGET_CLASS", | |
| "TARGET_NAME", | |
| "TDL", | |
| "Unnamed: 0" | |
| ] | |
| } | |
| }, | |
| "other": {}, | |
| "relations": [] | |
| } | |
| ], | |
| "meta": { | |
| "color": "orange", | |
| "inputs": [ | |
| { | |
| "name": "bundle", | |
| "position": "left", | |
| "type": { | |
| "type": "<class 'lynxkite_graph_analytics.core.Bundle'>" | |
| } | |
| } | |
| ], | |
| "name": "Parse SMILES", | |
| "outputs": [ | |
| { | |
| "name": "output", | |
| "position": "right", | |
| "type": { | |
| "type": "None" | |
| } | |
| } | |
| ], | |
| "params": [ | |
| { | |
| "default": "df", | |
| "name": "table", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| }, | |
| { | |
| "default": "SMILES", | |
| "name": "smiles_column", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| }, | |
| { | |
| "default": "mols", | |
| "name": "save_as", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| } | |
| ], | |
| "type": "basic" | |
| }, | |
| "params": { | |
| "save_as": "mols", | |
| "smiles_column": "SMILES", | |
| "table": "df" | |
| }, | |
| "status": "done", | |
| "title": "Parse SMILES" | |
| }, | |
| "dragHandle": ".bg-primary", | |
| "height": 200.0, | |
| "id": "Parse SMILES 1", | |
| "position": { | |
| "x": 580.5892989328847, | |
| "y": 1012.8823965480503 | |
| }, | |
| "type": "basic", | |
| "width": 200.0 | |
| }, | |
| { | |
| "data": { | |
| "__execution_delay": 0.0, | |
| "collapsed": null, | |
| "display": null, | |
| "error": null, | |
| "input_metadata": [ | |
| { | |
| "dataframes": { | |
| "df": { | |
| "columns": [ | |
| "ACCESSION", | |
| "ACTION_TYPE", | |
| "ACT_COMMENT", | |
| "ACT_SOURCE", | |
| "ACT_SOURCE_URL", | |
| "ACT_TYPE", | |
| "ACT_UNIT", | |
| "ACT_VALUE", | |
| "DRUG_NAME", | |
| "GENE", | |
| "INN", | |
| "InChI", | |
| "InChIKey", | |
| "MOA", | |
| "MOA_SOURCE", | |
| "MOA_SOURCE_URL", | |
| "ORGANISM", | |
| "RELATION", | |
| "SMILES", | |
| "STRUCT_ID", | |
| "SWISSPROT", | |
| "TARGET_CLASS", | |
| "TARGET_NAME", | |
| "TDL", | |
| "Unnamed: 0", | |
| "mols" | |
| ] | |
| } | |
| }, | |
| "other": {}, | |
| "relations": [] | |
| } | |
| ], | |
| "meta": { | |
| "color": "orange", | |
| "inputs": [ | |
| { | |
| "name": "bundle", | |
| "position": "left", | |
| "type": { | |
| "type": "<class 'lynxkite_graph_analytics.core.Bundle'>" | |
| } | |
| } | |
| ], | |
| "name": "Graph from molecule similarity", | |
| "outputs": [ | |
| { | |
| "name": "output", | |
| "position": "right", | |
| "type": { | |
| "type": "None" | |
| } | |
| } | |
| ], | |
| "params": [ | |
| { | |
| "default": "df", | |
| "name": "table", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| }, | |
| { | |
| "default": "mols", | |
| "name": "mols_column", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| }, | |
| { | |
| "default": 10, | |
| "name": "average_degree", | |
| "type": { | |
| "type": "<class 'int'>" | |
| } | |
| } | |
| ], | |
| "type": "basic" | |
| }, | |
| "params": { | |
| "average_degree": "3", | |
| "mols_column": "mols", | |
| "table": "df" | |
| }, | |
| "status": "done", | |
| "title": "Graph from molecule similarity" | |
| }, | |
| "dragHandle": ".bg-primary", | |
| "height": 200.0, | |
| "id": "Graph from molecule similarity 1", | |
| "position": { | |
| "x": 926.4337192214458, | |
| "y": 1014.4451876264845 | |
| }, | |
| "type": "basic", | |
| "width": 200.0 | |
| }, | |
| { | |
| "data": { | |
| "__execution_delay": 0.0, | |
| "collapsed": null, | |
| "display": { | |
| "animationDuration": 500, | |
| "animationEasingUpdate": "quinticInOut", | |
| "series": [ | |
| { | |
| "data": [ | |
| { | |
| "id": "0", | |
| "itemStyle": { | |
| "color": "#a6cee3" | |
| }, | |
| "label": { | |
| "show": true | |
| }, | |
| "name": "phencyclidine", | |
| "symbolSize": 22.360679774997894, | |
| "value": "Torpedo californica", | |
| "x": 0.10782539581500938, | |
| "y": -0.23839701129914528 | |
| }, | |
| { | |
| "id": "1", | |
| "itemStyle": { | |
| "color": "#1f78b4" | |
| }, | |
| "label": { | |
| "show": true | |
| }, | |
| "name": "triazolam", | |
| "symbolSize": 22.360679774997894, | |
| "value": "Homo sapiens", | |
| "x": -0.10748868396434766, | |
| "y": 0.19422487376381423 | |
| }, | |
| { | |
| "id": "2", | |
| "itemStyle": { | |
| "color": "#1f78b4" | |
| }, | |
| "label": { | |
| "show": true | |
| }, | |
| "name": "gentian violet", | |
| "symbolSize": 22.360679774997894, | |
| "value": "Homo sapiens", | |
| "x": 0.32091925175898867, | |
| "y": 0.37711363327258846 | |
| }, | |
| { | |
| "id": "3", | |
| "itemStyle": { | |
| "color": "#1f78b4" | |
| }, | |
| "label": { | |
| "show": true | |
| }, | |
| "name": "ipratropium", | |
| "symbolSize": 22.360679774997894, | |
| "value": "Homo sapiens", | |
| "x": 0.6787440363904107, | |
| "y": -0.24483461144842011 | |
| }, | |
| { | |
| "id": "4", | |
| "itemStyle": { | |
| "color": "#1f78b4" | |
| }, | |
| "label": { | |
| "show": true | |
| }, | |
| "name": "deoxycholic acid", | |
| "symbolSize": 22.360679774997894, | |
| "value": "Homo sapiens", | |
| "x": -1.0, | |
| "y": -0.08810688428883728 | |
| } | |
| ], | |
| "emphasis": { | |
| "focus": "adjacency", | |
| "lineStyle": { | |
| "width": 10 | |
| } | |
| }, | |
| "label": { | |
| "formatter": "{b}", | |
| "position": "top" | |
| }, | |
| "lineStyle": { | |
| "color": "gray", | |
| "curveness": 0.3 | |
| }, | |
| "links": [ | |
| { | |
| "lineStyle": { | |
| "color": "#440154" | |
| }, | |
| "source": "3", | |
| "target": "4", | |
| "value": "0.8481012658227848" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#3a538b" | |
| }, | |
| "source": "0", | |
| "target": "1", | |
| "value": "0.8813559322033898" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#3a538b" | |
| }, | |
| "source": "0", | |
| "target": "4", | |
| "value": "0.8813559322033898" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#26818e" | |
| }, | |
| "source": "0", | |
| "target": "3", | |
| "value": "0.9047619047619048" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#23898d" | |
| }, | |
| "source": "1", | |
| "target": "2", | |
| "value": "0.9090909090909091" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#1ea087" | |
| }, | |
| "source": "1", | |
| "target": "3", | |
| "value": "0.921875" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#3ebc73" | |
| }, | |
| "source": "0", | |
| "target": "2", | |
| "value": "0.9375" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#4fc369" | |
| }, | |
| "source": "1", | |
| "target": "4", | |
| "value": "0.9420289855072463" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#9fd938" | |
| }, | |
| "source": "2", | |
| "target": "4", | |
| "value": "0.9589041095890412" | |
| }, | |
| { | |
| "lineStyle": { | |
| "color": "#fde724" | |
| }, | |
| "source": "2", | |
| "target": "3", | |
| "value": "0.9775280898876404" | |
| } | |
| ], | |
| "type": "graph" | |
| } | |
| ], | |
| "tooltip": { | |
| "show": true | |
| } | |
| }, | |
| "error": null, | |
| "input_metadata": [ | |
| { | |
| "dataframes": { | |
| "edges": { | |
| "columns": [ | |
| "similarity", | |
| "source", | |
| "target" | |
| ] | |
| }, | |
| "nodes": { | |
| "columns": [ | |
| "ACCESSION", | |
| "ACTION_TYPE", | |
| "ACT_COMMENT", | |
| "ACT_SOURCE", | |
| "ACT_SOURCE_URL", | |
| "ACT_TYPE", | |
| "ACT_UNIT", | |
| "ACT_VALUE", | |
| "DRUG_NAME", | |
| "GENE", | |
| "INN", | |
| "InChI", | |
| "InChIKey", | |
| "MOA", | |
| "MOA_SOURCE", | |
| "MOA_SOURCE_URL", | |
| "ORGANISM", | |
| "RELATION", | |
| "SMILES", | |
| "STRUCT_ID", | |
| "SWISSPROT", | |
| "TARGET_CLASS", | |
| "TARGET_NAME", | |
| "TDL", | |
| "Unnamed: 0", | |
| "mols" | |
| ] | |
| } | |
| }, | |
| "other": {}, | |
| "relations": [ | |
| { | |
| "df": "edges", | |
| "name": null, | |
| "source_column": "source", | |
| "source_key": "id", | |
| "source_table": "nodes", | |
| "target_column": "target", | |
| "target_key": "id", | |
| "target_table": "nodes" | |
| } | |
| ] | |
| } | |
| ], | |
| "meta": { | |
| "color": "orange", | |
| "inputs": [ | |
| { | |
| "name": "graph", | |
| "position": "left", | |
| "type": { | |
| "type": "<class 'lynxkite_graph_analytics.core.Bundle'>" | |
| } | |
| } | |
| ], | |
| "name": "Visualize graph", | |
| "outputs": [], | |
| "params": [ | |
| { | |
| "default": null, | |
| "name": "color_nodes_by", | |
| "type": { | |
| "format": "node attribute" | |
| } | |
| }, | |
| { | |
| "default": null, | |
| "name": "label_by", | |
| "type": { | |
| "format": "node attribute" | |
| } | |
| }, | |
| { | |
| "default": null, | |
| "name": "color_edges_by", | |
| "type": { | |
| "format": "edge attribute" | |
| } | |
| } | |
| ], | |
| "type": "visualization" | |
| }, | |
| "params": { | |
| "color_edges_by": "similarity", | |
| "color_nodes_by": "ORGANISM", | |
| "label_by": "DRUG_NAME" | |
| }, | |
| "status": "done", | |
| "title": "Visualize graph" | |
| }, | |
| "dragHandle": ".bg-primary", | |
| "height": 314.0, | |
| "id": "Visualize graph 1", | |
| "position": { | |
| "x": 1254.2277640235457, | |
| "y": 931.9705991370125 | |
| }, | |
| "type": "visualization", | |
| "width": 407.0 | |
| }, | |
| { | |
| "data": { | |
| "__execution_delay": 0.0, | |
| "collapsed": null, | |
| "display": null, | |
| "error": null, | |
| "input_metadata": [ | |
| { | |
| "dataframes": { | |
| "edges": { | |
| "columns": [ | |
| "similarity", | |
| "source", | |
| "target" | |
| ] | |
| }, | |
| "nodes": { | |
| "columns": [ | |
| "ACCESSION", | |
| "ACTION_TYPE", | |
| "ACT_COMMENT", | |
| "ACT_SOURCE", | |
| "ACT_SOURCE_URL", | |
| "ACT_TYPE", | |
| "ACT_UNIT", | |
| "ACT_VALUE", | |
| "DRUG_NAME", | |
| "GENE", | |
| "INN", | |
| "InChI", | |
| "InChIKey", | |
| "MOA", | |
| "MOA_SOURCE", | |
| "MOA_SOURCE_URL", | |
| "ORGANISM", | |
| "RELATION", | |
| "SMILES", | |
| "STRUCT_ID", | |
| "SWISSPROT", | |
| "TARGET_CLASS", | |
| "TARGET_NAME", | |
| "TDL", | |
| "Unnamed: 0", | |
| "mols" | |
| ] | |
| } | |
| }, | |
| "other": {}, | |
| "relations": [ | |
| { | |
| "df": "edges", | |
| "name": null, | |
| "source_column": "source", | |
| "source_key": "id", | |
| "source_table": "nodes", | |
| "target_column": "target", | |
| "target_key": "id", | |
| "target_table": "nodes" | |
| } | |
| ] | |
| } | |
| ], | |
| "meta": { | |
| "color": "orange", | |
| "inputs": [ | |
| { | |
| "name": "bundle", | |
| "position": "left", | |
| "type": { | |
| "type": "<class 'lynxkite_graph_analytics.core.Bundle'>" | |
| } | |
| } | |
| ], | |
| "name": "Cypher", | |
| "outputs": [ | |
| { | |
| "name": "output", | |
| "position": "right", | |
| "type": { | |
| "type": "None" | |
| } | |
| } | |
| ], | |
| "params": [ | |
| { | |
| "default": null, | |
| "name": "query", | |
| "type": { | |
| "format": "textarea" | |
| } | |
| }, | |
| { | |
| "default": "result", | |
| "name": "save_as", | |
| "type": { | |
| "type": "<class 'str'>" | |
| } | |
| } | |
| ], | |
| "type": "basic" | |
| }, | |
| "params": { | |
| "query": "MATCH\n (a {ORGANISM: \"Homo sapiens\"})\n -[r]->\n (b {ORGANISM: \"Homo sapiens\"})\nWHERE\n r.similarity > 0.9\nRETURN a.DRUG_NAME, b.DRUG_NAME", | |
| "save_as": "result" | |
| }, | |
| "status": "done", | |
| "title": "Cypher" | |
| }, | |
| "dragHandle": ".bg-primary", | |
| "height": 267.0, | |
| "id": "Cypher 1", | |
| "position": { | |
| "x": 1209.2024653849007, | |
| "y": 1567.9825632648467 | |
| }, | |
| "type": "basic", | |
| "width": 434.0 | |
| }, | |
| { | |
| "data": { | |
| "__execution_delay": null, | |
| "collapsed": null, | |
| "display": { | |
| "dataframes": { | |
| "edges": { | |
| "columns": [ | |
| "source", | |
| "target", | |
| "similarity" | |
| ], | |
| "data": [ | |
| [ | |
| 3.0, | |
| 4.0, | |
| 0.8481012658227848 | |
| ], | |
| [ | |
| 0.0, | |
| 1.0, | |
| 0.8813559322033898 | |
| ], | |
| [ | |
| 0.0, | |
| 4.0, | |
| 0.8813559322033898 | |
| ], | |
| [ | |
| 0.0, | |
| 3.0, | |
| 0.9047619047619048 | |
| ], | |
| [ | |
| 1.0, | |
| 2.0, | |
| 0.9090909090909091 | |
| ], | |
| [ | |
| 1.0, | |
| 3.0, | |
| 0.921875 | |
| ], | |
| [ | |
| 0.0, | |
| 2.0, | |
| 0.9375 | |
| ], | |
| [ | |
| 1.0, | |
| 4.0, | |
| 0.9420289855072463 | |
| ], | |
| [ | |
| 2.0, | |
| 4.0, | |
| 0.9589041095890412 | |
| ], | |
| [ | |
| 2.0, | |
| 3.0, | |
| 0.9775280898876404 | |
| ] | |
| ] | |
| }, | |
| "nodes": { | |
| "columns": [ | |
| "Unnamed: 0", | |
| "DRUG_NAME", | |
| "STRUCT_ID", | |
| "TARGET_NAME", | |
| "TARGET_CLASS", | |
| "ACCESSION", | |
| "GENE", | |
| "SWISSPROT", | |
| "ACT_VALUE", | |
| "ACT_UNIT", | |
| "ACT_TYPE", | |
| "ACT_COMMENT", | |
| "ACT_SOURCE", | |
| "RELATION", | |
| "MOA", | |
| "MOA_SOURCE", | |
| "ACT_SOURCE_URL", | |
| "MOA_SOURCE_URL", | |
| "ACTION_TYPE", | |
| "TDL", | |
| "ORGANISM", | |
| "SMILES", | |
| "InChI", | |
| "InChIKey", | |
| "INN", | |
| "mols" | |
| ], | |
| "data": [ | |
| [ | |
| 9737, | |
| "phencyclidine", | |
| 2121, | |
| "Acetylcholine receptor subunit alpha", | |
| "Ion channel", | |
| "P02710", | |
| "CHRNA1", | |
| "ACHA_TORCA", | |
| 6.66, | |
| NaN, | |
| "IC50", | |
| "Displacement of [3H]PCP from nAChR in Torpedo nobiliana electric organs membranes in presence of 100 uM carbachol by scintillation counting method", | |
| "CHEMBL", | |
| "=", | |
| NaN, | |
| "nan", | |
| NaN, | |
| "nan", | |
| "nan", | |
| "nan", | |
| "Torpedo californica", | |
| "C1CCN(CC1)C1(CCCCC1)C1=CC=CC=C1", | |
| "InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2", | |
| "JTJMJGYZQZDUJJ-UHFFFAOYSA-N", | |
| "phencyclidine", | |
| "<rdkit.Chem.rdchem.Mol object at 0x70fb3f748120>" | |
| ], | |
| [ | |
| 12934, | |
| "triazolam", | |
| 2729, | |
| "GABA A receptor alpha-3/beta-2/gamma-2", | |
| "Ion channel", | |
| "P18507|P34903|P47870", | |
| "GABRG2|GABRA3|GABRB2", | |
| "GBRG2_HUMAN|GBRA3_HUMAN|GBRB2_HUMAN", | |
| 8.876, | |
| NaN, | |
| "Ki", | |
| "nan", | |
| "WOMBAT-PK", | |
| "=", | |
| 1.0, | |
| "CHEMBL", | |
| NaN, | |
| "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL646", | |
| "POSITIVE ALLOSTERIC MODULATOR", | |
| "Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin", | |
| "Homo sapiens", | |
| "CC1=NN=C2CN=C(C3=CC(Cl)=CC=C3N12)C1=C(Cl)C=CC=C1", | |
| "InChI=1S/C17H12Cl2N4/c1-10-21-22-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)23(10)16/h2-8H,9H2,1H3", | |
| "JOFWLTCLBGQGBO-UHFFFAOYSA-N", | |
| "triazolam", | |
| "<rdkit.Chem.rdchem.Mol object at 0x70fb3f748430>" | |
| ], | |
| [ | |
| 15266, | |
| "gentian violet", | |
| 4138, | |
| "D(2) dopamine receptor", | |
| "GPCR", | |
| "P14416", | |
| "DRD2", | |
| "DRD2_HUMAN", | |
| 5.975, | |
| NaN, | |
| "Ki", | |
| "DRUGMATRIX: Dopamine D2L radioligand binding (ligand: [3H] Spiperone)", | |
| "DRUG MATRIX", | |
| "=", | |
| NaN, | |
| "nan", | |
| NaN, | |
| "nan", | |
| "nan", | |
| "Tclin", | |
| "Homo sapiens", | |
| "CN(C)C1=CC=C(C=C1)C(C1=CC=C(C=C1)N(C)C)=C1C=CC(C=C1)=[N+](C)C", | |
| "InChI=1S/C25H30N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18H,1-6H3/q+1", | |
| "LGLFFNDHMLKUMI-UHFFFAOYSA-N", | |
| "gentian violet", | |
| "<rdkit.Chem.rdchem.Mol object at 0x70fb3f7483c0>" | |
| ], | |
| [ | |
| 6488, | |
| "ipratropium", | |
| 1475, | |
| "Muscarinic acetylcholine receptor M1", | |
| "GPCR", | |
| "P11229", | |
| "CHRM1", | |
| "ACM1_HUMAN", | |
| 9.31, | |
| NaN, | |
| "Ki", | |
| "nan", | |
| "WOMBAT-PK", | |
| "=", | |
| NaN, | |
| "nan", | |
| NaN, | |
| "nan", | |
| "nan", | |
| "Tclin", | |
| "Homo sapiens", | |
| "CC(C)[N+]1(C)[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)C1=CC=CC=C1", | |
| "InChI=1S/C20H30NO3/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15/h4-8,14,16-19,22H,9-13H2,1-3H3/q+1/t16-,17+,18+,19?,21?", | |
| "OEXHQOGQTVQTAT-BHIXFJMTSA-N", | |
| "ipratropium", | |
| "<rdkit.Chem.rdchem.Mol object at 0x70fb3f7484a0>" | |
| ], | |
| [ | |
| 17453, | |
| "deoxycholic acid", | |
| 4988, | |
| "G-protein coupled bile acid receptor 1", | |
| "GPCR", | |
| "Q8TDU6", | |
| "GPBAR1", | |
| "GPBAR_HUMAN", | |
| 6.2, | |
| NaN, | |
| "EC50", | |
| "nan", | |
| "IUPHAR", | |
| "=", | |
| NaN, | |
| "nan", | |
| NaN, | |
| "nan", | |
| "AGONIST", | |
| "Tchem", | |
| "Homo sapiens", | |
| "C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C", | |
| "InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1", | |
| "KXGVEGMKQFWNSR-LLQZFEROSA-N", | |
| "deoxycholic acid", | |
| "<rdkit.Chem.rdchem.Mol object at 0x70fb3f748510>" | |
| ] | |
| ] | |
| }, | |
| "result": { | |
| "columns": [ | |
| "a.DRUG_NAME", | |
| "b.DRUG_NAME" | |
| ], | |
| "data": [ | |
| [ | |
| "triazolam", | |
| "gentian violet" | |
| ], | |
| [ | |
| "triazolam", | |
| "ipratropium" | |
| ], | |
| [ | |
| "triazolam", | |
| "deoxycholic acid" | |
| ], | |
| [ | |
| "gentian violet", | |
| "deoxycholic acid" | |
| ], | |
| [ | |
| "gentian violet", | |
| "ipratropium" | |
| ] | |
| ] | |
| } | |
| }, | |
| "other": {}, | |
| "relations": [ | |
| { | |
| "df": "edges", | |
| "name": null, | |
| "source_column": "source", | |
| "source_key": "id", | |
| "source_table": "nodes", | |
| "target_column": "target", | |
| "target_key": "id", | |
| "target_table": "nodes" | |
| } | |
| ] | |
| }, | |
| "error": null, | |
| "input_metadata": [ | |
| { | |
| "dataframes": { | |
| "edges": { | |
| "columns": [ | |
| "similarity", | |
| "source", | |
| "target" | |
| ] | |
| }, | |
| "nodes": { | |
| "columns": [ | |
| "ACCESSION", | |
| "ACTION_TYPE", | |
| "ACT_COMMENT", | |
| "ACT_SOURCE", | |
| "ACT_SOURCE_URL", | |
| "ACT_TYPE", | |
| "ACT_UNIT", | |
| "ACT_VALUE", | |
| "DRUG_NAME", | |
| "GENE", | |
| "INN", | |
| "InChI", | |
| "InChIKey", | |
| "MOA", | |
| "MOA_SOURCE", | |
| "MOA_SOURCE_URL", | |
| "ORGANISM", | |
| "RELATION", | |
| "SMILES", | |
| "STRUCT_ID", | |
| "SWISSPROT", | |
| "TARGET_CLASS", | |
| "TARGET_NAME", | |
| "TDL", | |
| "Unnamed: 0", | |
| "mols" | |
| ] | |
| }, | |
| "result": { | |
| "columns": [ | |
| "a.DRUG_NAME", | |
| "b.DRUG_NAME" | |
| ] | |
| } | |
| }, | |
| "other": {}, | |
| "relations": [ | |
| { | |
| "df": "edges", | |
| "name": null, | |
| "source_column": "source", | |
| "source_key": "id", | |
| "source_table": "nodes", | |
| "target_column": "target", | |
| "target_key": "id", | |
| "target_table": "nodes" | |
| } | |
| ] | |
| } | |
| ], | |
| "meta": { | |
| "color": "orange", | |
| "inputs": [ | |
| { | |
| "name": "bundle", | |
| "position": "left", | |
| "type": { | |
| "type": "<class 'lynxkite_graph_analytics.core.Bundle'>" | |
| } | |
| } | |
| ], | |
| "name": "View tables", | |
| "outputs": [], | |
| "params": [ | |
| { | |
| "default": 100, | |
| "name": "limit", | |
| "type": { | |
| "type": "<class 'int'>" | |
| } | |
| } | |
| ], | |
| "type": "table_view" | |
| }, | |
| "params": { | |
| "_tables_open": { | |
| "result": true | |
| }, | |
| "limit": 100.0 | |
| }, | |
| "status": "done", | |
| "title": "View tables" | |
| }, | |
| "dragHandle": ".bg-primary", | |
| "height": 295.0, | |
| "id": "View tables 1", | |
| "position": { | |
| "x": 1817.1767094971015, | |
| "y": 1459.025582190881 | |
| }, | |
| "type": "table_view", | |
| "width": 322.0 | |
| } | |
| ] | |
| } | |